C20H31N5O2 — CID 119047912
N-[(1-tert-butyltriazol-4-yl)methyl]-1-[3-(2-morpholin-4-ylethoxy)phenyl]methanamine (PubChem CID 119047912) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-1-[3-(2-morpholin-4-ylethoxy)phenyl]methanamine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-1-[3-(2-morpholin-4-ylethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 119047912 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-1-[3-(2-morpholin-4-ylethoxy)phenyl]methanamine |
| SMILES | CC(C)(C)n1cc(CNCc2cccc(OCCN3CCOCC3)c2)nn1 |
| InChI | InChI=1S/C20H31N5O2/c1-20(2,3)25-16-18(22-23-25)15-21-14-17-5-4-6-19(13-17)27-12-9-24-7-10-26-11-8-24/h4-6,13,16,21H,7-12,14-15H2,1-3H3 |
| InChIKey | WAOZPYNDBZGZLW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |