C17H23N3O3S — CID 175901661
3-[(2-ethyl-1,4-diazepan-1-yl)sulfonyl]-1-methoxyisoquinoline (PubChem CID 175901661) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 3-[(2-ethyl-1,4-diazepan-1-yl)sulfonyl]-1-methoxyisoquinoline.
| Compound Name | 3-[(2-ethyl-1,4-diazepan-1-yl)sulfonyl]-1-methoxyisoquinoline |
|---|---|
| PubChem CID | 175901661 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-[(2-ethyl-1,4-diazepan-1-yl)sulfonyl]-1-methoxyisoquinoline |
| SMILES | CCC1CNCCCN1S(=O)(=O)c1cc2ccccc2c(OC)n1 |
| InChI | InChI=1S/C17H23N3O3S/c1-3-14-12-18-9-6-10-20(14)24(21,22)16-11-13-7-4-5-8-15(13)17(19-16)23-2/h4-5,7-8,11,14,18H,3,6,9-10,12H2,1-2H3 |
| InChIKey | QYUAITUNURCLSQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |