C20H29N3O3S — CID 175901780
1-methoxy-3-[[2-(3-methylbutyl)-1,4-diazepan-1-yl]sulfonyl]isoquinoline (PubChem CID 175901780) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-methoxy-3-[[2-(3-methylbutyl)-1,4-diazepan-1-yl]sulfonyl]isoquinoline.
| Compound Name | 1-methoxy-3-[[2-(3-methylbutyl)-1,4-diazepan-1-yl]sulfonyl]isoquinoline |
|---|---|
| PubChem CID | 175901780 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-methoxy-3-[[2-(3-methylbutyl)-1,4-diazepan-1-yl]sulfonyl]isoquinoline |
| SMILES | COc1nc(S(=O)(=O)N2CCCNCC2CCC(C)C)cc2ccccc12 |
| InChI | InChI=1S/C20H29N3O3S/c1-15(2)9-10-17-14-21-11-6-12-23(17)27(24,25)19-13-16-7-4-5-8-18(16)20(22-19)26-3/h4-5,7-8,13,15,17,21H,6,9-12,14H2,1-3H3 |
| InChIKey | BIKVJVFAXUQMHO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |