C9H15N3O2 — CID 175901685
4-(2-morpholin-4-ylethyl)-1,3-oxazol-2-amine (PubChem CID 175901685) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(2-morpholin-4-ylethyl)-1,3-oxazol-2-amine.
| Compound Name | 4-(2-morpholin-4-ylethyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 175901685 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(2-morpholin-4-ylethyl)-1,3-oxazol-2-amine |
| SMILES | Nc1nc(CCN2CCOCC2)co1 |
| InChI | InChI=1S/C9H15N3O2/c10-9-11-8(7-14-9)1-2-12-3-5-13-6-4-12/h7H,1-6H2,(H2,10,11) |
| InChIKey | QQOGLVWKVPWWII-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |