C10H17N5O — CID 154327108
5-(2-morpholin-4-ylethyl)pyrimidine-4,6-diamine (PubChem CID 154327108) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-(2-morpholin-4-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-(2-morpholin-4-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 154327108 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5-(2-morpholin-4-ylethyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(N)c1CCN1CCOCC1 |
| InChI | InChI=1S/C10H17N5O/c11-9-8(10(12)14-7-13-9)1-2-15-3-5-16-6-4-15/h7H,1-6H2,(H4,11,12,13,14) |
| InChIKey | QSOBAVPPODRUCH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |