C23H22F2N2O4S — CID 175906946
1'-[3-(difluoromethoxy)phenyl]-N-(3-methyloxathiolan-3-yl)-2'-oxospiro[cyclobutane-1,3'-indole]-5'-carboxamide (PubChem CID 175906946) has the molecular formula C23H22F2N2O4S and a molecular weight of 460.50 g/mol. Its IUPAC name is 1'-[3-(difluoromethoxy)phenyl]-N-(3-methyloxathiolan-3-yl)-2'-oxospiro[cyclobutane-1,3'-indole]-5'-carboxamide.
| Compound Name | 1'-[3-(difluoromethoxy)phenyl]-N-(3-methyloxathiolan-3-yl)-2'-oxospiro[cyclobutane-1,3'-indole]-5'-carboxamide |
|---|---|
| PubChem CID | 175906946 |
| Molecular Formula | C23H22F2N2O4S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1'-[3-(difluoromethoxy)phenyl]-N-(3-methyloxathiolan-3-yl)-2'-oxospiro[cyclobutane-1,3'-indole]-5'-carboxamide |
| SMILES | CC1(NC(=O)c2ccc3c(c2)C2(CCC2)C(=O)N3c2cccc(OC(F)F)c2)CCOS1 |
| InChI | InChI=1S/C23H22F2N2O4S/c1-22(10-11-30-32-22)26-19(28)14-6-7-18-17(12-14)23(8-3-9-23)20(29)27(18)15-4-2-5-16(13-15)31-21(24)25/h2,4-7,12-13,21H,3,8-11H2,1H3,(H,26,28) |
| InChIKey | OIQHZUMXDCDOSQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|