C23H24F2N2O4S — CID 175443175
(3S)-1-[3-(difluoromethoxy)phenyl]-3-ethyl-3-methyl-N-(3-methyloxathiolan-3-yl)-2-oxoindole-5-carboxamide (PubChem CID 175443175) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is (3S)-1-[3-(difluoromethoxy)phenyl]-3-ethyl-3-methyl-N-(3-methyloxathiolan-3-yl)-2-oxoindole-5-carboxamide.
| Compound Name | (3S)-1-[3-(difluoromethoxy)phenyl]-3-ethyl-3-methyl-N-(3-methyloxathiolan-3-yl)-2-oxoindole-5-carboxamide |
|---|---|
| PubChem CID | 175443175 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (3S)-1-[3-(difluoromethoxy)phenyl]-3-ethyl-3-methyl-N-(3-methyloxathiolan-3-yl)-2-oxoindole-5-carboxamide |
| SMILES | CC[C@]1(C)C(=O)N(c2cccc(OC(F)F)c2)c2ccc(C(=O)NC3(C)CCOS3)cc21 |
| InChI | InChI=1S/C23H24F2N2O4S/c1-4-22(2)17-12-14(19(28)26-23(3)10-11-30-32-23)8-9-18(17)27(20(22)29)15-6-5-7-16(13-15)31-21(24)25/h5-9,12-13,21H,4,10-11H2,1-3H3,(H,26,28)/t22-,23?/m0/s1 |
| InChIKey | UPHRJYZWDNZZHB-NQCNTLBGSA-N |
| XLogP | 5.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|