C21H23F3N2O3 — CID 110201065
7-hydroxy-1-methyl-N-[3-(trifluoromethoxy)phenyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide (PubChem CID 110201065) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 7-hydroxy-1-methyl-N-[3-(trifluoromethoxy)phenyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide.
| Compound Name | 7-hydroxy-1-methyl-N-[3-(trifluoromethoxy)phenyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
|---|---|
| PubChem CID | 110201065 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 7-hydroxy-1-methyl-N-[3-(trifluoromethoxy)phenyl]-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
| SMILES | CN1CCCCCC(O)c2cc(C(=O)Nc3cccc(OC(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C21H23F3N2O3/c1-26-11-4-2-3-8-19(27)17-12-14(9-10-18(17)26)20(28)25-15-6-5-7-16(13-15)29-21(22,23)24/h5-7,9-10,12-13,19,27H,2-4,8,11H2,1H3,(H,25,28) |
| InChIKey | BHXDEECZRAQGAA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |