C9H10FNO2 — CID 175907153
3-fluoro-4-(2-hydroxyethyl)benzamide (PubChem CID 175907153) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is 3-fluoro-4-(2-hydroxyethyl)benzamide.
| Compound Name | 3-fluoro-4-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 175907153 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 3-fluoro-4-(2-hydroxyethyl)benzamide |
| SMILES | NC(=O)c1ccc(CCO)c(F)c1 |
| InChI | InChI=1S/C9H10FNO2/c10-8-5-7(9(11)13)2-1-6(8)3-4-12/h1-2,5,12H,3-4H2,(H2,11,13) |
| InChIKey | GCBMDIHRJOMRPH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |