C10H10FNO4S — CID 60982846
2-[(4-carbamoyl-2-fluorophenyl)methylsulfinyl]acetic acid (PubChem CID 60982846) has the molecular formula C10H10FNO4S and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(4-carbamoyl-2-fluorophenyl)methylsulfinyl]acetic acid.
| Compound Name | 2-[(4-carbamoyl-2-fluorophenyl)methylsulfinyl]acetic acid |
|---|---|
| PubChem CID | 60982846 |
| Molecular Formula | C10H10FNO4S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-[(4-carbamoyl-2-fluorophenyl)methylsulfinyl]acetic acid |
| SMILES | NC(=O)c1ccc(CS(=O)CC(=O)O)c(F)c1 |
| InChI | InChI=1S/C10H10FNO4S/c11-8-3-6(10(12)15)1-2-7(8)4-17(16)5-9(13)14/h1-3H,4-5H2,(H2,12,15)(H,13,14) |
| InChIKey | AEOWWJPLOOVSKJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |