C11H12FNO5S — CID 24711821
2-[(4-carbamoyl-2-fluorophenyl)methylsulfonyl]propanoic acid (PubChem CID 24711821) has the molecular formula C11H12FNO5S and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-[(4-carbamoyl-2-fluorophenyl)methylsulfonyl]propanoic acid.
| Compound Name | 2-[(4-carbamoyl-2-fluorophenyl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 24711821 |
| Molecular Formula | C11H12FNO5S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-[(4-carbamoyl-2-fluorophenyl)methylsulfonyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Cc1ccc(C(N)=O)cc1F |
| InChI | InChI=1S/C11H12FNO5S/c1-6(11(15)16)19(17,18)5-8-3-2-7(10(13)14)4-9(8)12/h2-4,6H,5H2,1H3,(H2,13,14)(H,15,16) |
| InChIKey | MYQXXYPYILAZES-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |