C12H23NO8 — CID 175908505
1-(diethylamino)ethanol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175908505) has the molecular formula C12H23NO8 and a molecular weight of 309.31 g/mol. Its IUPAC name is 1-(diethylamino)ethanol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-(diethylamino)ethanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175908505 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(diethylamino)ethanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)C(C)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H15NO.C6H8O7/c1-4-7(5-2)6(3)8;7-3(8)1-6(13,5(11)12)2-4(9)10/h6,8H,4-5H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ZUAVYWYMTWZPGH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|