C9H14ClNO2 — CID 175909559
2-ethyl-N,N-dihydroxy-4-methylaniline;hydrochloride (PubChem CID 175909559) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 2-ethyl-N,N-dihydroxy-4-methylaniline;hydrochloride.
| Compound Name | 2-ethyl-N,N-dihydroxy-4-methylaniline;hydrochloride |
|---|---|
| PubChem CID | 175909559 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-ethyl-N,N-dihydroxy-4-methylaniline;hydrochloride |
| SMILES | CCc1cc(C)ccc1N(O)O.Cl |
| InChI | InChI=1S/C9H13NO2.ClH/c1-3-8-6-7(2)4-5-9(8)10(11)12;/h4-6,11-12H,3H2,1-2H3;1H |
| InChIKey | QJQZVFIKURHTOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|