C10H15NO2 — CID 23084353
N,N-dihydroxy-4-methyl-2-propylaniline (PubChem CID 23084353) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N,N-dihydroxy-4-methyl-2-propylaniline.
| Compound Name | N,N-dihydroxy-4-methyl-2-propylaniline |
|---|---|
| PubChem CID | 23084353 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N,N-dihydroxy-4-methyl-2-propylaniline |
| SMILES | CCCc1cc(C)ccc1N(O)O |
| InChI | InChI=1S/C10H15NO2/c1-3-4-9-7-8(2)5-6-10(9)11(12)13/h5-7,12-13H,3-4H2,1-2H3 |
| InChIKey | OXCNCSRAUQIXSP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|