C20H15N5 — CID 175911527
2,2-bis(2H-indazol-3-yl)spiro[2.2]pentane-1-carbonitrile (PubChem CID 175911527) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is 2,2-bis(2H-indazol-3-yl)spiro[2.2]pentane-1-carbonitrile.
| Compound Name | 2,2-bis(2H-indazol-3-yl)spiro[2.2]pentane-1-carbonitrile |
|---|---|
| PubChem CID | 175911527 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2,2-bis(2H-indazol-3-yl)spiro[2.2]pentane-1-carbonitrile |
| SMILES | N#CC1C2(CC2)C1(c1[nH]nc2ccccc12)c1[nH]nc2ccccc12 |
| InChI | InChI=1S/C20H15N5/c21-11-16-19(9-10-19)20(16,17-12-5-1-3-7-14(12)22-24-17)18-13-6-2-4-8-15(13)23-25-18/h1-8,16H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | CRUUKQCHNQCJHQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |