C17H15N3 — CID 123384854
4-(2H-indazol-3-yl)-4-phenylbutanenitrile (PubChem CID 123384854) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-(2H-indazol-3-yl)-4-phenylbutanenitrile.
| Compound Name | 4-(2H-indazol-3-yl)-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 123384854 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-(2H-indazol-3-yl)-4-phenylbutanenitrile |
| SMILES | N#CCCC(c1ccccc1)c1[nH]nc2ccccc12 |
| InChI | InChI=1S/C17H15N3/c18-12-6-10-14(13-7-2-1-3-8-13)17-15-9-4-5-11-16(15)19-20-17/h1-5,7-9,11,14H,6,10H2,(H,19,20) |
| InChIKey | QEZHVCNSHNXUPN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |