C19H22N2 — CID 70588560
4-(dimethylamino)-5,5-diphenylpentanenitrile (PubChem CID 70588560) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(dimethylamino)-5,5-diphenylpentanenitrile.
| Compound Name | 4-(dimethylamino)-5,5-diphenylpentanenitrile |
|---|---|
| PubChem CID | 70588560 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-(dimethylamino)-5,5-diphenylpentanenitrile |
| SMILES | CN(C)C(CCC#N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-21(2)18(14-9-15-20)19(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18-19H,9,14H2,1-2H3 |
| InChIKey | SIJQBYLFSNXYGR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |