C13H16N2O2 — CID 19096755
2-[(3-cyano-1-phenylpropyl)amino]propanoic acid (PubChem CID 19096755) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[(3-cyano-1-phenylpropyl)amino]propanoic acid.
| Compound Name | 2-[(3-cyano-1-phenylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 19096755 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[(3-cyano-1-phenylpropyl)amino]propanoic acid |
| SMILES | CC(NC(CCC#N)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O2/c1-10(13(16)17)15-12(8-5-9-14)11-6-3-2-4-7-11/h2-4,6-7,10,12,15H,5,8H2,1H3,(H,16,17) |
| InChIKey | LKDCBCJCOBPHPQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |