C30H32F3N5O5S — CID 175911750
1-[2-[2-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]thieno[3,2-b]pyridin-7-yl]-4,6-dimethyl-3-pyridinyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175911750) has the molecular formula C30H32F3N5O5S and a molecular weight of 631.68 g/mol. Its IUPAC name is 1-[2-[2-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]thieno[3,2-b]pyridin-7-yl]-4,6-dimethyl-3-pyridinyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-[2-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]thieno[3,2-b]pyridin-7-yl]-4,6-dimethyl-3-pyridinyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175911750 |
| Molecular Formula | C30H32F3N5O5S |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 1-[2-[2-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]thieno[3,2-b]pyridin-7-yl]-4,6-dimethyl-3-pyridinyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)c(N2CCC(C(N)=O)CC2)c(-c2ccnc3cc(CN4C(=O)C5C(C4=O)C5(C)C)sc23)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H31N5O3S.C2HF3O2/c1-14-11-15(2)31-22(23(14)32-9-6-16(7-10-32)25(29)34)18-5-8-30-19-12-17(37-24(18)19)13-33-26(35)20-21(27(33)36)28(20,3)4;3-2(4,5)1(6)7/h5,8,11-12,16,20-21H,6-7,9-10,13H2,1-4H3,(H2,29,34);(H,6,7) |
| InChIKey | AAEWQZYNUUNDGM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|