C39H46ClN5O6 — CID 175912229
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[(3R)-2,6-dioxopiperidin-3-yl]-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl]butyl]benzamide (PubChem CID 175912229) has the molecular formula C39H46ClN5O6 and a molecular weight of 716.28 g/mol. Its IUPAC name is N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[(3R)-2,6-dioxopiperidin-3-yl]-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl]butyl]benzamide.
| Compound Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[(3R)-2,6-dioxopiperidin-3-yl]-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl]butyl]benzamide |
|---|---|
| PubChem CID | 175912229 |
| Molecular Formula | C39H46ClN5O6 |
| Molecular Weight | 716.28 g/mol |
| Exact Mass | 715.31 |
| IUPAC Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[(3R)-2,6-dioxopiperidin-3-yl]-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl]butyl]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(CCCCN3CCC4(CC3)CC(=O)N([C@@H]3CCC(=O)NC3=O)C4=O)cc2)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C39H46ClN5O6/c1-37(2)34(38(3,4)35(37)51-27-13-12-26(23-41)28(40)21-27)43-32(48)25-10-8-24(9-11-25)7-5-6-18-44-19-16-39(17-20-44)22-31(47)45(36(39)50)29-14-15-30(46)42-33(29)49/h8-13,21,29,34-35H,5-7,14-20,22H2,1-4H3,(H,43,48)(H,42,46,49)/t29-,34?,35?/m1/s1 |
| InChIKey | HVLYBGWUDSRAMM-GVOFKLESSA-N |
| XLogP | 4.79 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|