C43H45F3N6O6 — CID 140861012
N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propyl]benzamide (PubChem CID 140861012) has the molecular formula C43H45F3N6O6 and a molecular weight of 798.86 g/mol. Its IUPAC name is N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propyl]benzamide.
| Compound Name | N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 140861012 |
| Molecular Formula | C43H45F3N6O6 |
| Molecular Weight | 798.86 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propyl]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(CCCN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)cc2)C(C)(C)C1Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C43H45F3N6O6/c1-41(2)39(42(3,4)40(41)58-29-13-11-27(24-47)32(23-29)43(44,45)46)49-35(54)26-9-7-25(8-10-26)6-5-17-50-18-20-51(21-19-50)28-12-14-30-31(22-28)38(57)52(37(30)56)33-15-16-34(53)48-36(33)55/h7-14,22-23,33,39-40H,5-6,15-21H2,1-4H3,(H,49,54)(H,48,53,55) |
| InChIKey | NSYXJTFALSMXIU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|