C42H43F3N6O7 — CID 140860717
N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]benzamide (PubChem CID 140860717) has the molecular formula C42H43F3N6O7 and a molecular weight of 800.83 g/mol. Its IUPAC name is N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]benzamide.
| Compound Name | N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 140860717 |
| Molecular Formula | C42H43F3N6O7 |
| Molecular Weight | 800.83 g/mol |
| Exact Mass | 800.31 |
| IUPAC Name | N-[3-[4-cyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]-4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(N3CCN(CCOc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)cc2)C(C)(C)C1Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C42H43F3N6O7/c1-40(2)38(41(3,4)39(40)58-28-10-7-25(23-46)31(22-28)42(43,44)45)48-34(53)24-5-8-26(9-6-24)50-17-15-49(16-18-50)19-20-57-27-11-12-29-30(21-27)37(56)51(36(29)55)32-13-14-33(52)47-35(32)54/h5-12,21-22,32,38-39H,13-20H2,1-4H3,(H,48,53)(H,47,52,54) |
| InChIKey | QUGGIAXYFCFZPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|