C45H47N7O7 — CID 155278013
N-[3-(8-cyanoquinolin-5-yl)oxy-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propoxy]benzamide (PubChem CID 155278013) has the molecular formula C45H47N7O7 and a molecular weight of 797.91 g/mol. Its IUPAC name is N-[3-(8-cyanoquinolin-5-yl)oxy-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propoxy]benzamide.
| Compound Name | N-[3-(8-cyanoquinolin-5-yl)oxy-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 155278013 |
| Molecular Formula | C45H47N7O7 |
| Molecular Weight | 797.91 g/mol |
| Exact Mass | 797.35 |
| IUPAC Name | N-[3-(8-cyanoquinolin-5-yl)oxy-2,2,4,4-tetramethylcyclobutyl]-4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]propoxy]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(OCCCN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)cc2)C(C)(C)C1Oc1ccc(C#N)c2ncccc12 |
| InChI | InChI=1S/C45H47N7O7/c1-44(2)42(45(3,4)43(44)59-35-16-10-28(26-46)37-32(35)7-5-18-47-37)49-38(54)27-8-12-30(13-9-27)58-24-6-19-50-20-22-51(23-21-50)29-11-14-31-33(25-29)41(57)52(40(31)56)34-15-17-36(53)48-39(34)55/h5,7-14,16,18,25,34,42-43H,6,15,17,19-24H2,1-4H3,(H,49,54)(H,48,53,55) |
| InChIKey | OCCVSQYFYICLHD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|