C23H27N4O3S+ — CID 175914377
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 175914377) has the molecular formula C23H27N4O3S+ and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 175914377 |
| Molecular Formula | C23H27N4O3S+ |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c[n+](CC2CC2)c2ccccn12 |
| InChI | InChI=1S/C23H27N4O3S/c28-23-20(18-25(16-19-9-10-19)22-8-4-5-11-27(22)23)17-24-12-14-26(15-13-24)31(29,30)21-6-2-1-3-7-21/h1-8,11,18-19H,9-10,12-17H2/q+1 |
| InChIKey | FIMZBZKPYKBORW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|