About dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide
dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide (PubChem CID 175914856) has the molecular formula F2Li2N2O6S3
and a molecular weight of 272.09 g/mol. Its IUPAC name is dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide.
Molecular Properties
| Compound Name | dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide |
| PubChem CID | 175914856 |
| Molecular Formula | F2Li2N2O6S3 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.92 |
| IUPAC Name | dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide |
| SMILES | O=S(=O)(F)[N-]S(=O)(=O)[N-]S(=O)(=O)F.[Li+].[Li+] |
| InChI | InChI=1S/F2N2O6S3.2Li/c1-11(5,6)3-13(9,10)4-12(2,7)8;;/q-2;2*+1 |
| InChIKey | MSEYHOAAQLIXAS-UHFFFAOYSA-N |
| XLogP | -6.58 |
| TPSA | 130.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide?
The IUPAC name of dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide (CID 175914856) is dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide.
What is the SMILES notation for dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide?
The canonical SMILES for dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide is O=S(=O)(F)[N-]S(=O)(=O)[N-]S(=O)(=O)F.[Li+].[Li+].
What is the InChIKey of dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide?
The InChIKey is MSEYHOAAQLIXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/F2N2O6S3.2Li/c1-11(5,6)3-13(9,10)4-12(2,7)8;;/q-2;2*+1.
What are the key properties of dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide?
dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide has a molecular weight of 272.09 g/mol, XLogP of -6.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;fluorosulfonyl(fluorosulfonylazanidylsulfonyl)azanide is sourced from PubChem (CID 175914856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).