C32H30F2N4O5 — CID 175916506
(3R)-1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-6-nitro-2-(oxan-4-ylmethoxy)quinazolin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 175916506) has the molecular formula C32H30F2N4O5 and a molecular weight of 588.61 g/mol. Its IUPAC name is (3R)-1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-6-nitro-2-(oxan-4-ylmethoxy)quinazolin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-6-nitro-2-(oxan-4-ylmethoxy)quinazolin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 175916506 |
| Molecular Formula | C32H30F2N4O5 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | (3R)-1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-6-nitro-2-(oxan-4-ylmethoxy)quinazolin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C#Cc1c(F)ccc2cccc(-c3c([N+](=O)[O-])cc4c(N5CCC[C@@](C)(O)C5)nc(OCC5CCOCC5)nc4c3F)c12 |
| InChI | InChI=1S/C32H30F2N4O5/c1-3-21-24(33)9-8-20-6-4-7-22(26(20)21)27-25(38(40)41)16-23-29(28(27)34)35-31(43-17-19-10-14-42-15-11-19)36-30(23)37-13-5-12-32(2,39)18-37/h1,4,6-9,16,19,39H,5,10-15,17-18H2,2H3/t32-/m1/s1 |
| InChIKey | CFMWXLUKMIMRFW-JGCGQSQUSA-N |
| XLogP | 5.77 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|