C36H40FN5O3 — CID 176968215
(3R)-1-[8-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-[[(3S,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 176968215) has the molecular formula C36H40FN5O3 and a molecular weight of 609.75 g/mol. Its IUPAC name is (3R)-1-[8-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-[[(3S,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-[8-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-[[(3S,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 176968215 |
| Molecular Formula | C36H40FN5O3 |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | (3R)-1-[8-ethyl-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-[[(3S,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C#Cc1c(F)ccc2cccc(-c3ncc4c(N5CCC[C@@](C)(O)C5)nc(OC[C@@]56CCCN5[C@H](CO)CC6)nc4c3CC)c12 |
| InChI | InChI=1S/C36H40FN5O3/c1-4-25-29(37)12-11-23-9-6-10-27(30(23)25)31-26(5-2)32-28(19-38-31)33(41-17-7-14-35(3,44)21-41)40-34(39-32)45-22-36-15-8-18-42(36)24(20-43)13-16-36/h1,6,9-12,19,24,43-44H,5,7-8,13-18,20-22H2,2-3H3/t24-,35+,36-/m0/s1 |
| InChIKey | GUQWONCMISYLLA-UGDCGOENSA-N |
| XLogP | 5.25 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|