C35H34F2N6O2 — CID 166157463
1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(3R,8R)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile (PubChem CID 166157463) has the molecular formula C35H34F2N6O2 and a molecular weight of 608.69 g/mol. Its IUPAC name is 1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(3R,8R)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile.
| Compound Name | 1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(3R,8R)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
|---|---|
| PubChem CID | 166157463 |
| Molecular Formula | C35H34F2N6O2 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 1-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(3R,8R)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepane-4-carbonitrile |
| SMILES | C#Cc1c(F)ccc2cccc(-c3ncc4c(N5CCCC(C#N)CC5)nc(OC[C@]56CCCN5[C@@H](CO)CC6)nc4c3F)c12 |
| InChI | InChI=1S/C35H34F2N6O2/c1-2-25-28(36)10-9-23-7-3-8-26(29(23)25)31-30(37)32-27(19-39-31)33(42-15-4-6-22(18-38)12-17-42)41-34(40-32)45-21-35-13-5-16-43(35)24(20-44)11-14-35/h1,3,7-10,19,22,24,44H,4-6,11-17,20-21H2/t22?,24-,35-/m1/s1 |
| InChIKey | FBPAORCHQRLCBR-MTNWYZFUSA-N |
| XLogP | 5.60 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|