C18H35NO3Si2 — CID 175916635
(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]azetidin-2-one (PubChem CID 175916635) has the molecular formula C18H35NO3Si2 and a molecular weight of 369.65 g/mol. Its IUPAC name is (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]azetidin-2-one.
| Compound Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]azetidin-2-one |
|---|---|
| PubChem CID | 175916635 |
| Molecular Formula | C18H35NO3Si2 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC#C[C@@H]1NC(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO3Si2/c1-17(2,3)23(7,8)21-13-11-12-14-15(16(20)19-14)22-24(9,10)18(4,5)6/h14-15H,13H2,1-10H3,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | QEMBNRLYXYMDED-LSDHHAIUSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|