C12H23NO2Si2 — CID 10754471
(3R)-3-methyl-4-(2-trimethylsilylethynyl)-3-trimethylsilyloxyazetidin-2-one (PubChem CID 10754471) has the molecular formula C12H23NO2Si2 and a molecular weight of 269.49 g/mol. Its IUPAC name is (3R)-3-methyl-4-(2-trimethylsilylethynyl)-3-trimethylsilyloxyazetidin-2-one.
| Compound Name | (3R)-3-methyl-4-(2-trimethylsilylethynyl)-3-trimethylsilyloxyazetidin-2-one |
|---|---|
| PubChem CID | 10754471 |
| Molecular Formula | C12H23NO2Si2 |
| Molecular Weight | 269.49 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3R)-3-methyl-4-(2-trimethylsilylethynyl)-3-trimethylsilyloxyazetidin-2-one |
| SMILES | C[C@]1(O[Si](C)(C)C)C(=O)NC1C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H23NO2Si2/c1-12(15-17(5,6)7)10(13-11(12)14)8-9-16(2,3)4/h10H,1-7H3,(H,13,14)/t10?,12-/m1/s1 |
| InChIKey | INGLSNXICXXFHJ-TVKKRMFBSA-N |
| XLogP | 1.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|