C11H20F3NO2Si — CID 72952499
3-methyl-3-triethylsilyloxy-4-(trifluoromethyl)azetidin-2-one (PubChem CID 72952499) has the molecular formula C11H20F3NO2Si and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-methyl-3-triethylsilyloxy-4-(trifluoromethyl)azetidin-2-one.
| Compound Name | 3-methyl-3-triethylsilyloxy-4-(trifluoromethyl)azetidin-2-one |
|---|---|
| PubChem CID | 72952499 |
| Molecular Formula | C11H20F3NO2Si |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-methyl-3-triethylsilyloxy-4-(trifluoromethyl)azetidin-2-one |
| SMILES | CC[Si](CC)(CC)OC1(C)C(=O)NC1C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2Si/c1-5-18(6-2,7-3)17-10(4)8(11(12,13)14)15-9(10)16/h8H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | FQTGKPFTPMUGFZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|