C22H30N4O6S — CID 175923691
3-[(1R,3S)-3-[3-[[2-(4-methoxy-2-methylsulfonylphenyl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid (PubChem CID 175923691) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-[(1R,3S)-3-[3-[[2-(4-methoxy-2-methylsulfonylphenyl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid.
| Compound Name | 3-[(1R,3S)-3-[3-[[2-(4-methoxy-2-methylsulfonylphenyl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid |
|---|---|
| PubChem CID | 175923691 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-[(1R,3S)-3-[3-[[2-(4-methoxy-2-methylsulfonylphenyl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid |
| SMILES | COc1ccc(CC(=O)Nc2cc([C@H]3CC[C@H](CCCNC(=O)O)C3)[nH]n2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H30N4O6S/c1-32-17-8-7-16(19(12-17)33(2,30)31)11-21(27)24-20-13-18(25-26-20)15-6-5-14(10-15)4-3-9-23-22(28)29/h7-8,12-15,23H,3-6,9-11H2,1-2H3,(H,28,29)(H2,24,25,26,27)/t14-,15-/m0/s1 |
| InChIKey | CPFGJTHXLLJTLI-GJZGRUSLSA-N |
| XLogP | 2.93 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|