C22H31N5O4 — CID 175923707
3-[(1S,3R)-3-[3-[[2-[2-(2-aminoethoxy)phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid (PubChem CID 175923707) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[(1S,3R)-3-[3-[[2-[2-(2-aminoethoxy)phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid.
| Compound Name | 3-[(1S,3R)-3-[3-[[2-[2-(2-aminoethoxy)phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid |
|---|---|
| PubChem CID | 175923707 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-[(1S,3R)-3-[3-[[2-[2-(2-aminoethoxy)phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl]propylcarbamic acid |
| SMILES | NCCOc1ccccc1CC(=O)Nc1cc([C@@H]2CC[C@@H](CCCNC(=O)O)C2)[nH]n1 |
| InChI | InChI=1S/C22H31N5O4/c23-9-11-31-19-6-2-1-5-17(19)13-21(28)25-20-14-18(26-27-20)16-8-7-15(12-16)4-3-10-24-22(29)30/h1-2,5-6,14-16,24H,3-4,7-13,23H2,(H,29,30)(H2,25,26,27,28)/t15-,16-/m1/s1 |
| InChIKey | OZRPSDHXXPKIQV-HZPDHXFCSA-N |
| XLogP | 2.86 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|