C14H20N4O2 — CID 175928487
N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 175928487) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 175928487 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | N#C[C@H](C[C@@H]1CCNC1=O)NC(=O)C1CC2(CC2)CN1 |
| InChI | InChI=1S/C14H20N4O2/c15-7-10(5-9-1-4-16-12(9)19)18-13(20)11-6-14(2-3-14)8-17-11/h9-11,17H,1-6,8H2,(H,16,19)(H,18,20)/t9-,10-,11?/m0/s1 |
| InChIKey | OSOIDOUSGUSGKG-QRHSGQBVSA-N |
| XLogP | -0.34 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |