C12H27Cl2NO6S2 — CID 175928528
[3-(2-acetyloxyethoxy)-2-hydroxypropyl]-[(3S)-3-amino-3-carboxypropyl]-methylsulfanium;sulfane;chloride;hydrochloride (PubChem CID 175928528) has the molecular formula C12H27Cl2NO6S2 and a molecular weight of 416.39 g/mol. Its IUPAC name is [3-(2-acetyloxyethoxy)-2-hydroxypropyl]-[(3S)-3-amino-3-carboxypropyl]-methylsulfanium;sulfane;chloride;hydrochloride.
| Compound Name | [3-(2-acetyloxyethoxy)-2-hydroxypropyl]-[(3S)-3-amino-3-carboxypropyl]-methylsulfanium;sulfane;chloride;hydrochloride |
|---|---|
| PubChem CID | 175928528 |
| Molecular Formula | C12H27Cl2NO6S2 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [3-(2-acetyloxyethoxy)-2-hydroxypropyl]-[(3S)-3-amino-3-carboxypropyl]-methylsulfanium;sulfane;chloride;hydrochloride |
| SMILES | CC(=O)OCCOCC(O)C[S+](C)CC[C@H](N)C(=O)O.Cl.S.[Cl-] |
| InChI | InChI=1S/C12H23NO6S.2ClH.H2S/c1-9(14)19-5-4-18-7-10(15)8-20(2)6-3-11(13)12(16)17;;;/h10-11,15H,3-8,13H2,1-2H3;2*1H;1H2/t10?,11-,20?;;;/m0.../s1 |
| InChIKey | QBOIXGFRRXOZEX-KFCYOIJVSA-N |
| XLogP | -3.48 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|