C14H30NO6S+ — CID 175928527
[(3S)-3-amino-3-carboxypropyl]-[3-[2-(2-ethoxyethoxy)ethoxy]-2-hydroxypropyl]-methylsulfanium (PubChem CID 175928527) has the molecular formula C14H30NO6S+ and a molecular weight of 340.46 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-[3-[2-(2-ethoxyethoxy)ethoxy]-2-hydroxypropyl]-methylsulfanium.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-[3-[2-(2-ethoxyethoxy)ethoxy]-2-hydroxypropyl]-methylsulfanium |
|---|---|
| PubChem CID | 175928527 |
| Molecular Formula | C14H30NO6S+ |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-[3-[2-(2-ethoxyethoxy)ethoxy]-2-hydroxypropyl]-methylsulfanium |
| SMILES | CCOCCOCCOCC(O)C[S+](C)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H29NO6S/c1-3-19-5-6-20-7-8-21-10-12(16)11-22(2)9-4-13(15)14(17)18/h12-13,16H,3-11,15H2,1-2H3/p+1/t12?,13-,22?/m0/s1 |
| InChIKey | HSWYGCQZEJPHHX-IZBMSLIKSA-O |
| XLogP | -0.53 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|