C8H6F2N2O — CID 175928722
5,7-difluoro-3-methoxy-1H-indazole (PubChem CID 175928722) has the molecular formula C8H6F2N2O and a molecular weight of 184.15 g/mol. Its IUPAC name is 5,7-difluoro-3-methoxy-1H-indazole.
| Compound Name | 5,7-difluoro-3-methoxy-1H-indazole |
|---|---|
| PubChem CID | 175928722 |
| Molecular Formula | C8H6F2N2O |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 5,7-difluoro-3-methoxy-1H-indazole |
| SMILES | COc1n[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C8H6F2N2O/c1-13-8-5-2-4(9)3-6(10)7(5)11-12-8/h2-3H,1H3,(H,11,12) |
| InChIKey | GGXWXNFJNHLJDR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |