C18H30O7Ti — CID 175929918
propan-2-yl 4-(4,6-dioxo-6-propan-2-yloxyhexan-3-yl)oxy-3-oxohexanoate;titanium (PubChem CID 175929918) has the molecular formula C18H30O7Ti and a molecular weight of 406.30 g/mol. Its IUPAC name is propan-2-yl 4-(4,6-dioxo-6-propan-2-yloxyhexan-3-yl)oxy-3-oxohexanoate;titanium.
| Compound Name | propan-2-yl 4-(4,6-dioxo-6-propan-2-yloxyhexan-3-yl)oxy-3-oxohexanoate;titanium |
|---|---|
| PubChem CID | 175929918 |
| Molecular Formula | C18H30O7Ti |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | propan-2-yl 4-(4,6-dioxo-6-propan-2-yloxyhexan-3-yl)oxy-3-oxohexanoate;titanium |
| SMILES | CCC(OC(CC)C(=O)CC(=O)OC(C)C)C(=O)CC(=O)OC(C)C.[Ti] |
| InChI | InChI=1S/C18H30O7.Ti/c1-7-15(13(19)9-17(21)23-11(3)4)25-16(8-2)14(20)10-18(22)24-12(5)6;/h11-12,15-16H,7-10H2,1-6H3; |
| InChIKey | NFPXJDZMOUCYCU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|