C16H17N3O4 — CID 175931869
1-methyl-5-(4-methyl-3-oxopiperazine-1-carbonyl)indole-2-carboxylic acid (PubChem CID 175931869) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-methyl-5-(4-methyl-3-oxopiperazine-1-carbonyl)indole-2-carboxylic acid.
| Compound Name | 1-methyl-5-(4-methyl-3-oxopiperazine-1-carbonyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175931869 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-methyl-5-(4-methyl-3-oxopiperazine-1-carbonyl)indole-2-carboxylic acid |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)cc(C(=O)O)n3C)CC1=O |
| InChI | InChI=1S/C16H17N3O4/c1-17-5-6-19(9-14(17)20)15(21)10-3-4-12-11(7-10)8-13(16(22)23)18(12)2/h3-4,7-8H,5-6,9H2,1-2H3,(H,22,23) |
| InChIKey | KITIQCAJFSUJBK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |