C10H15F4NO3S — CID 175932016
4-ethylsulfonyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butan-1-one (PubChem CID 175932016) has the molecular formula C10H15F4NO3S and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butan-1-one.
| Compound Name | 4-ethylsulfonyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 175932016 |
| Molecular Formula | C10H15F4NO3S |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-ethylsulfonyl-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butan-1-one |
| SMILES | CCS(=O)(=O)CCCC(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C10H15F4NO3S/c1-2-19(17,18)5-3-4-8(16)15-6-9(11,12)10(13,14)7-15/h2-7H2,1H3 |
| InChIKey | OEKHVHMXHJSERK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|