C10H16F3NO3S — CID 60707461
N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 60707461) has the molecular formula C10H16F3NO3S and a molecular weight of 287.30 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 60707461 |
| Molecular Formula | C10H16F3NO3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCN(C(=O)C(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16F3NO3S/c1-2-3-5-14(9(15)10(11,12)13)8-4-6-18(16,17)7-8/h8H,2-7H2,1H3 |
| InChIKey | UQMXDTSEXNSZEZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |