C8H15NO3S — CID 18573519
N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 18573519) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 18573519 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(C)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO3S/c1-3-9(7(2)10)8-4-5-13(11,12)6-8/h8H,3-6H2,1-2H3 |
| InChIKey | VVAQZDFSEBNQAI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |