C14H14ClF3N4O — CID 175936813
4-[6-chloro-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-yl]morpholine (PubChem CID 175936813) has the molecular formula C14H14ClF3N4O and a molecular weight of 346.74 g/mol. Its IUPAC name is 4-[6-chloro-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-yl]morpholine.
| Compound Name | 4-[6-chloro-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-yl]morpholine |
|---|---|
| PubChem CID | 175936813 |
| Molecular Formula | C14H14ClF3N4O |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[6-chloro-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-yl]morpholine |
| SMILES | FC(F)(F)c1cccc(N2CN=C(Cl)N=C2N2CCOCC2)c1 |
| InChI | InChI=1S/C14H14ClF3N4O/c15-12-19-9-22(13(20-12)21-4-6-23-7-5-21)11-3-1-2-10(8-11)14(16,17)18/h1-3,8H,4-7,9H2 |
| InChIKey | SVKNIHGQRGLKLZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|