C13H13ClF3N3O2 — CID 135516809
N-[C-morpholin-4-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]carbamoyl chloride (PubChem CID 135516809) has the molecular formula C13H13ClF3N3O2 and a molecular weight of 335.71 g/mol. Its IUPAC name is N-[C-morpholin-4-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]carbamoyl chloride.
| Compound Name | N-[C-morpholin-4-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]carbamoyl chloride |
|---|---|
| PubChem CID | 135516809 |
| Molecular Formula | C13H13ClF3N3O2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[C-morpholin-4-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]carbamoyl chloride |
| SMILES | O=C(Cl)N/C(=N\c1cccc(C(F)(F)F)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H13ClF3N3O2/c14-11(21)19-12(20-4-6-22-7-5-20)18-10-3-1-2-9(8-10)13(15,16)17/h1-3,8H,4-7H2,(H,18,19,21) |
| InChIKey | QDRVDAXUTITDNL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|