C26H23F2N3O2 — CID 175938860
2-(1-cyclopropyl-6-fluoroindol-4-yl)-6-fluoro-4-(piperidine-1-carbonyl)isoquinolin-1-one (PubChem CID 175938860) has the molecular formula C26H23F2N3O2 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-(1-cyclopropyl-6-fluoroindol-4-yl)-6-fluoro-4-(piperidine-1-carbonyl)isoquinolin-1-one.
| Compound Name | 2-(1-cyclopropyl-6-fluoroindol-4-yl)-6-fluoro-4-(piperidine-1-carbonyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 175938860 |
| Molecular Formula | C26H23F2N3O2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-(1-cyclopropyl-6-fluoroindol-4-yl)-6-fluoro-4-(piperidine-1-carbonyl)isoquinolin-1-one |
| SMILES | O=C(c1cn(-c2cc(F)cc3c2ccn3C2CC2)c(=O)c2ccc(F)cc12)N1CCCCC1 |
| InChI | InChI=1S/C26H23F2N3O2/c27-16-4-7-19-21(12-16)22(25(32)29-9-2-1-3-10-29)15-31(26(19)33)24-14-17(28)13-23-20(24)8-11-30(23)18-5-6-18/h4,7-8,11-15,18H,1-3,5-6,9-10H2 |
| InChIKey | MCRZNPUWGXWKRT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |