C25H25ClF4N5O2P — CID 175942464
7-chloro-6-fluoro-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-[2-[1-(trifluoromethyl)cyclopropyl]phenyl]pyrido[2,3-d]pyrimidin-2-one;phosphane (PubChem CID 175942464) has the molecular formula C25H25ClF4N5O2P and a molecular weight of 569.93 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-[2-[1-(trifluoromethyl)cyclopropyl]phenyl]pyrido[2,3-d]pyrimidin-2-one;phosphane.
| Compound Name | 7-chloro-6-fluoro-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-[2-[1-(trifluoromethyl)cyclopropyl]phenyl]pyrido[2,3-d]pyrimidin-2-one;phosphane |
|---|---|
| PubChem CID | 175942464 |
| Molecular Formula | C25H25ClF4N5O2P |
| Molecular Weight | 569.93 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 7-chloro-6-fluoro-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-[2-[1-(trifluoromethyl)cyclopropyl]phenyl]pyrido[2,3-d]pyrimidin-2-one;phosphane |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3ccccc3C3(C(F)(F)F)CC3)c3nc(Cl)c(F)cc23)[C@@H](C)C1.P |
| InChI | InChI=1S/C25H22ClF4N5O2.H3P/c1-3-19(36)33-10-11-34(14(2)13-33)21-15-12-17(27)20(26)31-22(15)35(23(37)32-21)18-7-5-4-6-16(18)24(8-9-24)25(28,29)30;/h3-7,12,14H,1,8-11,13H2,2H3;1H3/t14-;/m0./s1 |
| InChIKey | UZRJTRBPRRTLMO-UQKRIMTDSA-N |
| XLogP | 4.45 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|