C12H13ClN4 — CID 175943834
6-chloro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrazolo[4,3-c]pyridine (PubChem CID 175943834) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 6-chloro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 175943834 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 6-chloro-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrazolo[4,3-c]pyridine |
| SMILES | CN1CC=C(n2ncc3cnc(Cl)cc32)CC1 |
| InChI | InChI=1S/C12H13ClN4/c1-16-4-2-10(3-5-16)17-11-6-12(13)14-7-9(11)8-15-17/h2,6-8H,3-5H2,1H3 |
| InChIKey | JDSYAKPYEKYJCN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|