C33H31F2N5O3 — CID 175945100
1-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-6-methylnaphthalen-2-ol (PubChem CID 175945100) has the molecular formula C33H31F2N5O3 and a molecular weight of 583.64 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-6-methylnaphthalen-2-ol.
| Compound Name | 1-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-6-methylnaphthalen-2-ol |
|---|---|
| PubChem CID | 175945100 |
| Molecular Formula | C33H31F2N5O3 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-6-methylnaphthalen-2-ol |
| SMILES | Cc1ccc2c(-c3ncc4c(-c5ccc6n5CCOC6)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c(O)ccc2c1 |
| InChI | InChI=1S/C33H31F2N5O3/c1-19-3-6-23-20(13-19)4-8-26(41)27(23)31-28(35)30-24(15-36-31)29(25-7-5-22-17-42-12-11-40(22)25)37-32(38-30)43-18-33-9-2-10-39(33)16-21(34)14-33/h3-8,13,15,21,41H,2,9-12,14,16-18H2,1H3/t21-,33+/m1/s1 |
| InChIKey | VDMFCNHUJFHRMG-PPGPUPIYSA-N |
| XLogP | 5.95 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|