C33H29F2N7O2 — CID 169184730
4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoroquinolin-2-amine (PubChem CID 169184730) has the molecular formula C33H29F2N7O2 and a molecular weight of 593.64 g/mol. Its IUPAC name is 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoroquinolin-2-amine.
| Compound Name | 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoroquinolin-2-amine |
|---|---|
| PubChem CID | 169184730 |
| Molecular Formula | C33H29F2N7O2 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoroquinolin-2-amine |
| SMILES | C#Cc1c(F)ccc2nc(N)cc(-c3ncc4c(-c5ccc6n5CCOC6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H29F2N7O2/c1-2-20-23(34)6-7-24-27(20)21(15-26(36)38-24)30-28(35)31-22(16-37-30)29(25-8-5-19-17-43-14-13-42(19)25)39-32(40-31)44-18-33-9-3-11-41(33)12-4-10-33/h1,5-8,15-16H,3-4,9-14,17-18H2,(H2,36,38) |
| InChIKey | VJBOLUPRCOCZMQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|