C34H29F2N5O3 — CID 169184765
4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 169184765) has the molecular formula C34H29F2N5O3 and a molecular weight of 593.63 g/mol. Its IUPAC name is 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 169184765 |
| Molecular Formula | C34H29F2N5O3 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 4-[4-(3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(-c5cc6n(c5)CCOC6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C34H29F2N5O3/c1-2-24-27(35)6-5-20-14-23(42)15-25(28(20)24)31-29(36)32-26(16-37-31)30(21-13-22-18-43-12-11-40(22)17-21)38-33(39-32)44-19-34-7-3-9-41(34)10-4-8-34/h1,5-6,13-17,42H,3-4,7-12,18-19H2 |
| InChIKey | CHBADOTXPQYXJI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|